About CID 89365660
CID 89365660 (PubChem CID 89365660) has the molecular formula C23H21BClFN6O2S
and a molecular weight of 510.79 g/mol.
Molecular Properties
| Compound Name | CID 89365660 |
| PubChem CID | 89365660 |
| Molecular Formula | C23H21BClFN6O2S |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccnc3)cc(C3CCN(S(=O)(=O)c4cc(F)ccc4Cl)CC3)nc12 |
| InChI | InChI=1S/C23H21BClFN6O2S/c24-18-14-29-32-22(28-13-15-2-1-7-27-12-15)11-20(30-23(18)32)16-5-8-31(9-6-16)35(33,34)21-10-17(26)3-4-19(21)25/h1-4,7,10-12,14,16,28H,5-6,8-9,13H2 |
| InChIKey | BEDQMKCIICKVPW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89365660 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89365660?
The IUPAC name of CID 89365660 (CID 89365660) is not available.
What is the SMILES notation for CID 89365660?
The canonical SMILES for CID 89365660 is [B]c1cnn2c(NCc3cccnc3)cc(C3CCN(S(=O)(=O)c4cc(F)ccc4Cl)CC3)nc12.
What is the InChIKey of CID 89365660?
The InChIKey is BEDQMKCIICKVPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21BClFN6O2S/c24-18-14-29-32-22(28-13-15-2-1-7-27-12-15)11-20(30-23(18)32)16-5-8-31(9-6-16)35(33,34)21-10-17(26)3-4-19(21)25/h1-4,7,10-12,14,16,28H,5-6,8-9,13H2.
What are the key properties of CID 89365660?
CID 89365660 has a molecular weight of 510.79 g/mol, XLogP of 2.89, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89365660 is sourced from PubChem (CID 89365660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).