C23H22BClN6O2S — CID 89373674
CID 89373674 (PubChem CID 89373674) has the molecular formula C23H22BClN6O2S and a molecular weight of 492.80 g/mol.
| Compound Name | CID 89373674 |
|---|---|
| PubChem CID | 89373674 |
| Molecular Formula | C23H22BClN6O2S |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccnc3)cc(C3CCCN(S(=O)(=O)c4cccc(Cl)c4)C3)nc12 |
| InChI | InChI=1S/C23H22BClN6O2S/c24-20-14-28-31-22(27-13-16-4-2-8-26-12-16)11-21(29-23(20)31)17-5-3-9-30(15-17)34(32,33)19-7-1-6-18(25)10-19/h1-2,4,6-8,10-12,14,17,27H,3,5,9,13,15H2 |
| InChIKey | KEHJRIKKTALABL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|