C25H24BF3N6 — CID 89380013
CID 89380013 (PubChem CID 89380013) has the molecular formula C25H24BF3N6 and a molecular weight of 476.32 g/mol.
| Compound Name | CID 89380013 |
|---|---|
| PubChem CID | 89380013 |
| Molecular Formula | C25H24BF3N6 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccnc3)cc(C3CCCN(Cc4ccc(C(F)(F)F)cc4)C3)nc12 |
| InChI | InChI=1S/C25H24BF3N6/c26-21-14-32-35-23(31-13-18-3-1-9-30-12-18)11-22(33-24(21)35)19-4-2-10-34(16-19)15-17-5-7-20(8-6-17)25(27,28)29/h1,3,5-9,11-12,14,19,31H,2,4,10,13,15-16H2 |
| InChIKey | LXHOKCBBXZVDRW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|