C23H21BCl2N6O2S — CID 89298101
CID 89298101 (PubChem CID 89298101) has the molecular formula C23H21BCl2N6O2S and a molecular weight of 527.25 g/mol.
| Compound Name | CID 89298101 |
|---|---|
| PubChem CID | 89298101 |
| Molecular Formula | C23H21BCl2N6O2S |
| Molecular Weight | 527.25 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccnc3)cc(C3CCCN(S(=O)(=O)c4c(Cl)cccc4Cl)C3)nc12 |
| InChI | InChI=1S/C23H21BCl2N6O2S/c24-17-13-29-32-21(28-12-15-4-2-8-27-11-15)10-20(30-23(17)32)16-5-3-9-31(14-16)35(33,34)22-18(25)6-1-7-19(22)26/h1-2,4,6-8,10-11,13,16,28H,3,5,9,12,14H2 |
| InChIKey | YLJPZTPDKAHDLW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|