C20H22ClN3O — CID 88989099
2-amino-N-[4-[5-chloro-2-(methoxymethyl)phenyl]but-3-ynyl]-N'-methylbenzenecarboximidamide (PubChem CID 88989099) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is 2-amino-N-[4-[5-chloro-2-(methoxymethyl)phenyl]but-3-ynyl]-N'-methylbenzenecarboximidamide.
| Compound Name | 2-amino-N-[4-[5-chloro-2-(methoxymethyl)phenyl]but-3-ynyl]-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 88989099 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-amino-N-[4-[5-chloro-2-(methoxymethyl)phenyl]but-3-ynyl]-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\NCCC#Cc1cc(Cl)ccc1COC)c1ccccc1N |
| InChI | InChI=1S/C20H22ClN3O/c1-23-20(18-8-3-4-9-19(18)22)24-12-6-5-7-15-13-17(21)11-10-16(15)14-25-2/h3-4,8-11,13H,6,12,14,22H2,1-2H3,(H,23,24) |
| InChIKey | YWTRZCJDNYYUSH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|