C10H24NO7PS — CID 88991792
[(2S)-2-[(2S)-butan-2-yl]oxy-3-[ethyl(methylsulfonyl)amino]propyl] dihydrogen phosphate (PubChem CID 88991792) has the molecular formula C10H24NO7PS and a molecular weight of 333.34 g/mol. Its IUPAC name is [(2S)-2-[(2S)-butan-2-yl]oxy-3-[ethyl(methylsulfonyl)amino]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-[(2S)-butan-2-yl]oxy-3-[ethyl(methylsulfonyl)amino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 88991792 |
| Molecular Formula | C10H24NO7PS |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | [(2S)-2-[(2S)-butan-2-yl]oxy-3-[ethyl(methylsulfonyl)amino]propyl] dihydrogen phosphate |
| SMILES | CC[C@H](C)O[C@H](COP(=O)(O)O)CN(CC)S(C)(=O)=O |
| InChI | InChI=1S/C10H24NO7PS/c1-5-9(3)18-10(8-17-19(12,13)14)7-11(6-2)20(4,15)16/h9-10H,5-8H2,1-4H3,(H2,12,13,14)/t9-,10-/m0/s1 |
| InChIKey | YAVFXSWSOXCJKU-UWVGGRQHSA-N |
| XLogP | 0.56 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|