C14H31NO4S — CID 89118519
N-[(2R)-2-[(2S)-butan-2-yl]oxy-4-hydroxybutyl]-N-(2-methylbutan-2-yl)methanesulfonamide (PubChem CID 89118519) has the molecular formula C14H31NO4S and a molecular weight of 309.47 g/mol. Its IUPAC name is N-[(2R)-2-[(2S)-butan-2-yl]oxy-4-hydroxybutyl]-N-(2-methylbutan-2-yl)methanesulfonamide.
| Compound Name | N-[(2R)-2-[(2S)-butan-2-yl]oxy-4-hydroxybutyl]-N-(2-methylbutan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 89118519 |
| Molecular Formula | C14H31NO4S |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-[(2R)-2-[(2S)-butan-2-yl]oxy-4-hydroxybutyl]-N-(2-methylbutan-2-yl)methanesulfonamide |
| SMILES | CC[C@H](C)O[C@H](CCO)CN(C(C)(C)CC)S(C)(=O)=O |
| InChI | InChI=1S/C14H31NO4S/c1-7-12(3)19-13(9-10-16)11-15(20(6,17)18)14(4,5)8-2/h12-13,16H,7-11H2,1-6H3/t12-,13+/m0/s1 |
| InChIKey | HRMIQBIMGUZURK-QWHCGFSZSA-N |
| XLogP | 2.00 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |