C18H12ClN3OS — CID 88992383
1-[3-(4-amino-[1]benzothiolo[3,2-d]pyrimidin-7-yl)-2-chlorophenyl]ethenol (PubChem CID 88992383) has the molecular formula C18H12ClN3OS and a molecular weight of 353.83 g/mol. Its IUPAC name is 1-[3-(4-amino-[1]benzothiolo[3,2-d]pyrimidin-7-yl)-2-chlorophenyl]ethenol.
| Compound Name | 1-[3-(4-amino-[1]benzothiolo[3,2-d]pyrimidin-7-yl)-2-chlorophenyl]ethenol |
|---|---|
| PubChem CID | 88992383 |
| Molecular Formula | C18H12ClN3OS |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 1-[3-(4-amino-[1]benzothiolo[3,2-d]pyrimidin-7-yl)-2-chlorophenyl]ethenol |
| SMILES | C=C(O)c1cccc(-c2ccc3c(c2)sc2c(N)ncnc23)c1Cl |
| InChI | InChI=1S/C18H12ClN3OS/c1-9(23)11-3-2-4-12(15(11)19)10-5-6-13-14(7-10)24-17-16(13)21-8-22-18(17)20/h2-8,23H,1H2,(H2,20,21,22) |
| InChIKey | OXLCWNONWSFDDR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|