C24H18F3N3O2 — CID 88997763
N-[amino(phenyl)methylidene]-4-formyl-N'-[1-[2-hydroxy-4-(trifluoromethyl)phenyl]ethenyl]benzenecarboximidamide (PubChem CID 88997763) has the molecular formula C24H18F3N3O2 and a molecular weight of 437.42 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-4-formyl-N'-[1-[2-hydroxy-4-(trifluoromethyl)phenyl]ethenyl]benzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-4-formyl-N'-[1-[2-hydroxy-4-(trifluoromethyl)phenyl]ethenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 88997763 |
| Molecular Formula | C24H18F3N3O2 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[amino(phenyl)methylidene]-4-formyl-N'-[1-[2-hydroxy-4-(trifluoromethyl)phenyl]ethenyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/N)c1ccccc1)c1ccc(C=O)cc1)c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C24H18F3N3O2/c1-15(20-12-11-19(13-21(20)32)24(25,26)27)29-23(18-9-7-16(14-31)8-10-18)30-22(28)17-5-3-2-4-6-17/h2-14,32H,1H2,(H2,28,29,30) |
| InChIKey | BWEKWXHYEYXLEF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|