C42H40BF2N5OS — CID 88998604
CID 88998604 (PubChem CID 88998604) has the molecular formula C42H40BF2N5OS and a molecular weight of 711.69 g/mol.
| Compound Name | CID 88998604 |
|---|---|
| PubChem CID | 88998604 |
| Molecular Formula | C42H40BF2N5OS |
| Molecular Weight | 711.69 g/mol |
| Exact Mass | 711.30 |
| IUPAC Name | — |
| SMILES | [B]c1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)nc1NC(Cc1cc(F)cc(F)c1)C(O)CNC1CSCc2ccc(CC)cc21 |
| InChI | InChI=1S/C42H40BF2N5OS/c1-2-28-18-19-30-26-52-27-38(36(30)22-28)46-25-39(51)37(23-29-20-34(44)24-35(45)21-29)47-41-40(43)48-50(49-41)42(31-12-6-3-7-13-31,32-14-8-4-9-15-32)33-16-10-5-11-17-33/h3-22,24,37-39,46,51H,2,23,25-27H2,1H3,(H,47,49) |
| InChIKey | TXUNDQZVDFJORT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.69 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|