About cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile
cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile (PubChem CID 89002737) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile.
Analyze cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile?
The IUPAC name of cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile (CID 89002737) is cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile.
What is the SMILES notation for cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile?
The canonical SMILES for cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile is CC(C)[C@H]1C[C@@H]1C#N.
What is the InChIKey of cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile?
The InChIKey is BHKWBOSVLCLBQT-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H11N/c1-5(2)7-3-6(7)4-8/h5-7H,3H2,1-2H3/t6-,7-/m1/s1.
What are the key properties of cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile?
cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile has a molecular weight of 109.17 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-propan-2-ylcyclopropane-1-carbonitrile is sourced from PubChem (CID 89002737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).