C11H14N2S2 — CID 89003399
methyl N-(2,3-dihydro-1H-indol-2-ylmethyl)carbamodithioate (PubChem CID 89003399) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is methyl N-(2,3-dihydro-1H-indol-2-ylmethyl)carbamodithioate.
| Compound Name | methyl N-(2,3-dihydro-1H-indol-2-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 89003399 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | methyl N-(2,3-dihydro-1H-indol-2-ylmethyl)carbamodithioate |
| SMILES | CSC(=S)NCC1Cc2ccccc2N1 |
| InChI | InChI=1S/C11H14N2S2/c1-15-11(14)12-7-9-6-8-4-2-3-5-10(8)13-9/h2-5,9,13H,6-7H2,1H3,(H,12,14) |
| InChIKey | JWXUJVLPNINKGV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|