C16H26O5 — CID 89007131
(3R,4aS,7R,7aS,10R,11aR)-3,7,10-trimethyl-3-propyl-7,7a,8,9,10,11-hexahydro-4aH-[1,2,4]trioxino[6,5-j]isochromen-6-one (PubChem CID 89007131) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3R,4aS,7R,7aS,10R,11aR)-3,7,10-trimethyl-3-propyl-7,7a,8,9,10,11-hexahydro-4aH-[1,2,4]trioxino[6,5-j]isochromen-6-one.
| Compound Name | (3R,4aS,7R,7aS,10R,11aR)-3,7,10-trimethyl-3-propyl-7,7a,8,9,10,11-hexahydro-4aH-[1,2,4]trioxino[6,5-j]isochromen-6-one |
|---|---|
| PubChem CID | 89007131 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (3R,4aS,7R,7aS,10R,11aR)-3,7,10-trimethyl-3-propyl-7,7a,8,9,10,11-hexahydro-4aH-[1,2,4]trioxino[6,5-j]isochromen-6-one |
| SMILES | CCC[C@@]1(C)OO[C@]23C[C@H](C)CC[C@H]2[C@@H](C)C(=O)O[C@@H]3O1 |
| InChI | InChI=1S/C16H26O5/c1-5-8-15(4)19-14-16(21-20-15)9-10(2)6-7-12(16)11(3)13(17)18-14/h10-12,14H,5-9H2,1-4H3/t10-,11-,12+,14-,15-,16-/m1/s1 |
| InChIKey | KZZNVSYCOZIJNA-YZRJEHAMSA-N |
| XLogP | 3.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|