C23H27N5O3 — CID 89009283
8-(4-nitrosophenyl)-3-oxo-N-(2,4,6-trimethylphenyl)-1,2,8-triazaspiro[4.5]decane-1-carboxamide (PubChem CID 89009283) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 8-(4-nitrosophenyl)-3-oxo-N-(2,4,6-trimethylphenyl)-1,2,8-triazaspiro[4.5]decane-1-carboxamide.
| Compound Name | 8-(4-nitrosophenyl)-3-oxo-N-(2,4,6-trimethylphenyl)-1,2,8-triazaspiro[4.5]decane-1-carboxamide |
|---|---|
| PubChem CID | 89009283 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 8-(4-nitrosophenyl)-3-oxo-N-(2,4,6-trimethylphenyl)-1,2,8-triazaspiro[4.5]decane-1-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)N2NC(=O)CC23CCN(c2ccc(N=O)cc2)CC3)c(C)c1 |
| InChI | InChI=1S/C23H27N5O3/c1-15-12-16(2)21(17(3)13-15)24-22(30)28-23(14-20(29)25-28)8-10-27(11-9-23)19-6-4-18(26-31)5-7-19/h4-7,12-13H,8-11,14H2,1-3H3,(H,24,30)(H,25,29) |
| InChIKey | JFFVHKUYGJCWKM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|