C26H39N2O6P — CID 89021599
N-[(2R)-4-diethoxyphosphoryl-1-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methoxy]phenyl]pentan-2-yl]acetamide (PubChem CID 89021599) has the molecular formula C26H39N2O6P and a molecular weight of 506.58 g/mol. Its IUPAC name is N-[(2R)-4-diethoxyphosphoryl-1-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methoxy]phenyl]pentan-2-yl]acetamide.
| Compound Name | N-[(2R)-4-diethoxyphosphoryl-1-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methoxy]phenyl]pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 89021599 |
| Molecular Formula | C26H39N2O6P |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | N-[(2R)-4-diethoxyphosphoryl-1-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methoxy]phenyl]pentan-2-yl]acetamide |
| SMILES | CCOP(=O)(OCC)C(C)C[C@@H](Cc1ccc(OCc2ncc(C)c(OC)c2C)cc1)NC(C)=O |
| InChI | InChI=1S/C26H39N2O6P/c1-8-33-35(30,34-9-2)19(4)14-23(28-21(6)29)15-22-10-12-24(13-11-22)32-17-25-20(5)26(31-7)18(3)16-27-25/h10-13,16,19,23H,8-9,14-15,17H2,1-7H3,(H,28,29)/t19?,23-/m0/s1 |
| InChIKey | SDMOMLKUMNRKBG-BVHINDKJSA-N |
| XLogP | 5.38 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|