C38H61N2O6P — CID 10349530
[(3S)-4-[4-[2-(4-methoxy-3,5-dimethyl-2-pyridinyl)ethoxy]phenyl]-3-[[(Z)-octadec-9-enoyl]amino]butyl]phosphonic acid (PubChem CID 10349530) has the molecular formula C38H61N2O6P and a molecular weight of 672.89 g/mol. Its IUPAC name is [(3S)-4-[4-[2-(4-methoxy-3,5-dimethyl-2-pyridinyl)ethoxy]phenyl]-3-[[(Z)-octadec-9-enoyl]amino]butyl]phosphonic acid.
| Compound Name | [(3S)-4-[4-[2-(4-methoxy-3,5-dimethyl-2-pyridinyl)ethoxy]phenyl]-3-[[(Z)-octadec-9-enoyl]amino]butyl]phosphonic acid |
|---|---|
| PubChem CID | 10349530 |
| Molecular Formula | C38H61N2O6P |
| Molecular Weight | 672.89 g/mol |
| Exact Mass | 672.43 |
| IUPAC Name | [(3S)-4-[4-[2-(4-methoxy-3,5-dimethyl-2-pyridinyl)ethoxy]phenyl]-3-[[(Z)-octadec-9-enoyl]amino]butyl]phosphonic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](CCP(=O)(O)O)Cc1ccc(OCCc2ncc(C)c(OC)c2C)cc1 |
| InChI | InChI=1S/C38H61N2O6P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-37(41)40-34(26-28-47(42,43)44)29-33-21-23-35(24-22-33)46-27-25-36-32(3)38(45-4)31(2)30-39-36/h12-13,21-24,30,34H,5-11,14-20,25-29H2,1-4H3,(H,40,41)(H2,42,43,44)/b13-12-/t34-/m1/s1 |
| InChIKey | DPXZVDFRYZZJSX-SMRGPCJZSA-N |
| XLogP | 8.96 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.89 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|