C19H24O4 — CID 89025948
(10-methyl-12-oxo-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-4-yl) 2-methylprop-2-enoate (PubChem CID 89025948) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (10-methyl-12-oxo-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-4-yl) 2-methylprop-2-enoate.
| Compound Name | (10-methyl-12-oxo-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-4-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89025948 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (10-methyl-12-oxo-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-4-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1C1C3CC(C4C(C)OC(=O)C34)C21 |
| InChI | InChI=1S/C19H24O4/c1-7(2)18(20)23-13-5-9-4-10(13)16-12-6-11(15(9)16)14-8(3)22-19(21)17(12)14/h8-17H,1,4-6H2,2-3H3 |
| InChIKey | NIHXXMNQDLVIDO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|