C12H16BrN3O — CID 89033746
N-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-N'-but-3-enylethanimidamide (PubChem CID 89033746) has the molecular formula C12H16BrN3O and a molecular weight of 298.18 g/mol. Its IUPAC name is N-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-N'-but-3-enylethanimidamide.
| Compound Name | N-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-N'-but-3-enylethanimidamide |
|---|---|
| PubChem CID | 89033746 |
| Molecular Formula | C12H16BrN3O |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-N'-but-3-enylethanimidamide |
| SMILES | C=CCC/N=C(\C)Nc1cc(Br)cn(C)c1=O |
| InChI | InChI=1S/C12H16BrN3O/c1-4-5-6-14-9(2)15-11-7-10(13)8-16(3)12(11)17/h4,7-8H,1,5-6H2,2-3H3,(H,14,15) |
| InChIKey | KXDJMCNMFYZAFJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|