C22H23N3O4 — CID 89034522
N-hydroxy-2-[4-[[4-[(2-hydroxyethylamino)methyl]phenyl]methoxy]phenyl]pyridine-4-carboxamide (PubChem CID 89034522) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-hydroxy-2-[4-[[4-[(2-hydroxyethylamino)methyl]phenyl]methoxy]phenyl]pyridine-4-carboxamide.
| Compound Name | N-hydroxy-2-[4-[[4-[(2-hydroxyethylamino)methyl]phenyl]methoxy]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 89034522 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-hydroxy-2-[4-[[4-[(2-hydroxyethylamino)methyl]phenyl]methoxy]phenyl]pyridine-4-carboxamide |
| SMILES | O=C(NO)c1ccnc(-c2ccc(OCc3ccc(CNCCO)cc3)cc2)c1 |
| InChI | InChI=1S/C22H23N3O4/c26-12-11-23-14-16-1-3-17(4-2-16)15-29-20-7-5-18(6-8-20)21-13-19(9-10-24-21)22(27)25-28/h1-10,13,23,26,28H,11-12,14-15H2,(H,25,27) |
| InChIKey | QXQQYRZMMKSRBR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|