C18H18BNO3S — CID 89036654
CID 89036654 (PubChem CID 89036654) has the molecular formula C18H18BNO3S and a molecular weight of 339.23 g/mol.
| Compound Name | CID 89036654 |
|---|---|
| PubChem CID | 89036654 |
| Molecular Formula | C18H18BNO3S |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | — |
| SMILES | [B]c1c(C(OC(C)(C)C)C(=O)OC)sc2ccc3ncccc3c12 |
| InChI | InChI=1S/C18H18BNO3S/c1-18(2,3)23-15(17(21)22-4)16-14(19)13-10-6-5-9-20-11(10)7-8-12(13)24-16/h5-9,15H,1-4H3 |
| InChIKey | INETVLIRBDXAAJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|