C15H15N3OS — CID 118975129
1-[amino(propyl)amino]thieno[3,2-f]quinoline-2-carbaldehyde (PubChem CID 118975129) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 1-[amino(propyl)amino]thieno[3,2-f]quinoline-2-carbaldehyde.
| Compound Name | 1-[amino(propyl)amino]thieno[3,2-f]quinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 118975129 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 1-[amino(propyl)amino]thieno[3,2-f]quinoline-2-carbaldehyde |
| SMILES | CCCN(N)c1c(C=O)sc2ccc3ncccc3c12 |
| InChI | InChI=1S/C15H15N3OS/c1-2-8-18(16)15-13(9-19)20-12-6-5-11-10(14(12)15)4-3-7-17-11/h3-7,9H,2,8,16H2,1H3 |
| InChIKey | BHNXPSIJWGEVAX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|