C13H14FN3OS — CID 89044415
(2S)-N-(4-fluoro-1,3-benzothiazol-2-yl)piperidine-2-carboxamide (PubChem CID 89044415) has the molecular formula C13H14FN3OS and a molecular weight of 279.34 g/mol. Its IUPAC name is (2S)-N-(4-fluoro-1,3-benzothiazol-2-yl)piperidine-2-carboxamide.
| Compound Name | (2S)-N-(4-fluoro-1,3-benzothiazol-2-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 89044415 |
| Molecular Formula | C13H14FN3OS |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (2S)-N-(4-fluoro-1,3-benzothiazol-2-yl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1nc2c(F)cccc2s1)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C13H14FN3OS/c14-8-4-3-6-10-11(8)16-13(19-10)17-12(18)9-5-1-2-7-15-9/h3-4,6,9,15H,1-2,5,7H2,(H,16,17,18)/t9-/m0/s1 |
| InChIKey | GKASIQINPLEQQD-VIFPVBQESA-N |
| XLogP | 2.52 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |