About (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol
(4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol (PubChem CID 89044583) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol.
Molecular Properties
| Compound Name | (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol |
| PubChem CID | 89044583 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol |
| SMILES | C=C(OC)/C(C)=C/CC(CC)CO |
| InChI | InChI=1S/C11H20O2/c1-5-11(8-12)7-6-9(2)10(3)13-4/h6,11-12H,3,5,7-8H2,1-2,4H3/b9-6+ |
| InChIKey | QOMFIWOXIUSRLW-RMKNXTFCSA-N |
| XLogP | 2.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol?
The IUPAC name of (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol (CID 89044583) is (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol.
What is the SMILES notation for (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol?
The canonical SMILES for (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol is C=C(OC)/C(C)=C/CC(CC)CO.
What is the InChIKey of (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol?
The InChIKey is QOMFIWOXIUSRLW-RMKNXTFCSA-N. The full InChI is InChI=1S/C11H20O2/c1-5-11(8-12)7-6-9(2)10(3)13-4/h6,11-12H,3,5,7-8H2,1-2,4H3/b9-6+.
What are the key properties of (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol?
(4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol has a molecular weight of 184.28 g/mol, XLogP of 2.50, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-2-ethyl-6-methoxy-5-methylhepta-4,6-dien-1-ol is sourced from PubChem (CID 89044583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).