C29H35N5O — CID 89045784
amino N-[1-(3,5-dimethyl-4-prop-2-enylphenyl)ethenyl]-6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazole-3-carboximidate (PubChem CID 89045784) has the molecular formula C29H35N5O and a molecular weight of 469.63 g/mol. Its IUPAC name is amino N-[1-(3,5-dimethyl-4-prop-2-enylphenyl)ethenyl]-6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazole-3-carboximidate.
| Compound Name | amino N-[1-(3,5-dimethyl-4-prop-2-enylphenyl)ethenyl]-6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazole-3-carboximidate |
|---|---|
| PubChem CID | 89045784 |
| Molecular Formula | C29H35N5O |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | amino N-[1-(3,5-dimethyl-4-prop-2-enylphenyl)ethenyl]-6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazole-3-carboximidate |
| SMILES | C=CCc1c(C)cc(C(=C)/N=C(\ON)c2nn(Cc3cccnc3)c3c2CCC(C)(C)C3)cc1C |
| InChI | InChI=1S/C29H35N5O/c1-7-9-24-19(2)14-23(15-20(24)3)21(4)32-28(35-30)27-25-11-12-29(5,6)16-26(25)34(33-27)18-22-10-8-13-31-17-22/h7-8,10,13-15,17H,1,4,9,11-12,16,18,30H2,2-3,5-6H3/b32-28- |
| InChIKey | JCUBUVIUQRXHNG-BLCKFSMSSA-N |
| XLogP | 5.49 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|