C24H38N7O4P — CID 89051102
N-[4-amino-2-(2-diethoxyphosphorylethylamino)-6-[methyl-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]pyrimidin-5-yl]formamide (PubChem CID 89051102) has the molecular formula C24H38N7O4P and a molecular weight of 519.59 g/mol. Its IUPAC name is N-[4-amino-2-(2-diethoxyphosphorylethylamino)-6-[methyl-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]pyrimidin-5-yl]formamide.
| Compound Name | N-[4-amino-2-(2-diethoxyphosphorylethylamino)-6-[methyl-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]pyrimidin-5-yl]formamide |
|---|---|
| PubChem CID | 89051102 |
| Molecular Formula | C24H38N7O4P |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | N-[4-amino-2-(2-diethoxyphosphorylethylamino)-6-[methyl-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]pyrimidin-5-yl]formamide |
| SMILES | CCOP(=O)(CCNc1nc(N)c(NC=O)c(N(C)Cc2cccc(CN3CCCC3)c2)n1)OCC |
| InChI | InChI=1S/C24H38N7O4P/c1-4-34-36(33,35-5-2)14-11-26-24-28-22(25)21(27-18-32)23(29-24)30(3)16-19-9-8-10-20(15-19)17-31-12-6-7-13-31/h8-10,15,18H,4-7,11-14,16-17H2,1-3H3,(H,27,32)(H3,25,26,28,29) |
| InChIKey | RWHHAQWQROVUCU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|