C19H31N2O3P — CID 91261966
1-[[3-(3-diethoxyphosphorylprop-1-enyl)phenyl]methyl]-4-methylpiperazine (PubChem CID 91261966) has the molecular formula C19H31N2O3P and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-[[3-(3-diethoxyphosphorylprop-1-enyl)phenyl]methyl]-4-methylpiperazine.
| Compound Name | 1-[[3-(3-diethoxyphosphorylprop-1-enyl)phenyl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 91261966 |
| Molecular Formula | C19H31N2O3P |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-[[3-(3-diethoxyphosphorylprop-1-enyl)phenyl]methyl]-4-methylpiperazine |
| SMILES | CCOP(=O)(CC=Cc1cccc(CN2CCN(C)CC2)c1)OCC |
| InChI | InChI=1S/C19H31N2O3P/c1-4-23-25(22,24-5-2)15-7-10-18-8-6-9-19(16-18)17-21-13-11-20(3)12-14-21/h6-10,16H,4-5,11-15,17H2,1-3H3 |
| InChIKey | LYQZWNRTPIBARG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|