C18H28NO3P — CID 87575072
1-[[3-(1-diethoxyphosphorylprop-2-enyl)phenyl]methyl]pyrrolidine (PubChem CID 87575072) has the molecular formula C18H28NO3P and a molecular weight of 337.40 g/mol. Its IUPAC name is 1-[[3-(1-diethoxyphosphorylprop-2-enyl)phenyl]methyl]pyrrolidine.
| Compound Name | 1-[[3-(1-diethoxyphosphorylprop-2-enyl)phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 87575072 |
| Molecular Formula | C18H28NO3P |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[[3-(1-diethoxyphosphorylprop-2-enyl)phenyl]methyl]pyrrolidine |
| SMILES | C=CC(c1cccc(CN2CCCC2)c1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H28NO3P/c1-4-18(23(20,21-5-2)22-6-3)17-11-9-10-16(14-17)15-19-12-7-8-13-19/h4,9-11,14,18H,1,5-8,12-13,15H2,2-3H3 |
| InChIKey | SDFQOSCKPICOEK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|