C27H37N3O5S — CID 89057087
(2S,4S)-N-[3-[2-[4-(3,4-dimethoxyphenyl)butoxy]ethyl-methylcarbamoyl]phenyl]-4-sulfanylpyrrolidine-2-carboxamide (PubChem CID 89057087) has the molecular formula C27H37N3O5S and a molecular weight of 515.68 g/mol. Its IUPAC name is (2S,4S)-N-[3-[2-[4-(3,4-dimethoxyphenyl)butoxy]ethyl-methylcarbamoyl]phenyl]-4-sulfanylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-[3-[2-[4-(3,4-dimethoxyphenyl)butoxy]ethyl-methylcarbamoyl]phenyl]-4-sulfanylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89057087 |
| Molecular Formula | C27H37N3O5S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | (2S,4S)-N-[3-[2-[4-(3,4-dimethoxyphenyl)butoxy]ethyl-methylcarbamoyl]phenyl]-4-sulfanylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(CCCCOCCN(C)C(=O)c2cccc(NC(=O)[C@@H]3C[C@H](S)CN3)c2)cc1OC |
| InChI | InChI=1S/C27H37N3O5S/c1-30(12-14-35-13-5-4-7-19-10-11-24(33-2)25(15-19)34-3)27(32)20-8-6-9-21(16-20)29-26(31)23-17-22(36)18-28-23/h6,8-11,15-16,22-23,28,36H,4-5,7,12-14,17-18H2,1-3H3,(H,29,31)/t22-,23-/m0/s1 |
| InChIKey | UINHRFMCZMTRER-GOTSBHOMSA-N |
| XLogP | 3.41 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|