C22H27NO2 — CID 89060558
2-[(2R,6S)-2,3,3,4,4,5,5,6-octadeuterio-6-(2-hydroxy-2-phenylethyl)-1-methylpiperidin-2-yl]-1-phenylethanone (PubChem CID 89060558) has the molecular formula C22H27NO2 and a molecular weight of 345.51 g/mol. Its IUPAC name is 2-[(2R,6S)-2,3,3,4,4,5,5,6-octadeuterio-6-(2-hydroxy-2-phenylethyl)-1-methylpiperidin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(2R,6S)-2,3,3,4,4,5,5,6-octadeuterio-6-(2-hydroxy-2-phenylethyl)-1-methylpiperidin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 89060558 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 2-[(2R,6S)-2,3,3,4,4,5,5,6-octadeuterio-6-(2-hydroxy-2-phenylethyl)-1-methylpiperidin-2-yl]-1-phenylethanone |
| SMILES | [2H]C1([2H])C([2H])([2H])[C@@]([2H])(CC(O)c2ccccc2)N(C)[C@@]([2H])(CC(=O)c2ccccc2)C1([2H])[2H] |
| InChI | InChI=1S/C22H27NO2/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18/h2-7,9-12,19-21,24H,8,13-16H2,1H3/t19-,20+,21?/m0/s1/i8D2,13D2,14D2,19D,20D |
| InChIKey | MXYUKLILVYORSK-CSBXHEASSA-N |
| XLogP | 4.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |