C25H35Cl2N5O2 — CID 89062554
N'-[(2Z)-4-[2-(3,4-dichlorophenyl)ethylamino]-1-[4-[(3S)-3-hydroxypiperidin-1-yl]piperidin-1-yl]-3-methyl-1-oxopenta-2,4-dien-2-yl]methanimidamide (PubChem CID 89062554) has the molecular formula C25H35Cl2N5O2 and a molecular weight of 508.49 g/mol. Its IUPAC name is N'-[(2Z)-4-[2-(3,4-dichlorophenyl)ethylamino]-1-[4-[(3S)-3-hydroxypiperidin-1-yl]piperidin-1-yl]-3-methyl-1-oxopenta-2,4-dien-2-yl]methanimidamide.
| Compound Name | N'-[(2Z)-4-[2-(3,4-dichlorophenyl)ethylamino]-1-[4-[(3S)-3-hydroxypiperidin-1-yl]piperidin-1-yl]-3-methyl-1-oxopenta-2,4-dien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 89062554 |
| Molecular Formula | C25H35Cl2N5O2 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N'-[(2Z)-4-[2-(3,4-dichlorophenyl)ethylamino]-1-[4-[(3S)-3-hydroxypiperidin-1-yl]piperidin-1-yl]-3-methyl-1-oxopenta-2,4-dien-2-yl]methanimidamide |
| SMILES | C=C(NCCc1ccc(Cl)c(Cl)c1)/C(C)=C(\N=C\N)C(=O)N1CCC(N2CCC[C@H](O)C2)CC1 |
| InChI | InChI=1S/C25H35Cl2N5O2/c1-17(18(2)29-10-7-19-5-6-22(26)23(27)14-19)24(30-16-28)25(34)31-12-8-20(9-13-31)32-11-3-4-21(33)15-32/h5-6,14,16,20-21,29,33H,2-4,7-13,15H2,1H3,(H2,28,30)/b24-17-/t21-/m0/s1 |
| InChIKey | LCDNCQWFTPNGFV-HLJDWQABSA-N |
| XLogP | 3.35 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|