About CID 89063411
CID 89063411 (PubChem CID 89063411) has the molecular formula C2H6BO3P+
and a molecular weight of 119.85 g/mol.
Molecular Properties
| Compound Name | CID 89063411 |
| PubChem CID | 89063411 |
| Molecular Formula | C2H6BO3P+ |
| Molecular Weight | 119.85 g/mol |
| Exact Mass | 120.01 |
| IUPAC Name | — |
| SMILES | C[B]O[P+](=O)OC |
| InChI | InChI=1S/C2H6BO3P/c1-3-6-7(4)5-2/h1-2H3/q+1 |
| InChIKey | GIINDQZRRXXZDE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.85 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 89063411 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89063411?
The IUPAC name of CID 89063411 (CID 89063411) is not available.
What is the SMILES notation for CID 89063411?
The canonical SMILES for CID 89063411 is C[B]O[P+](=O)OC.
What is the InChIKey of CID 89063411?
The InChIKey is GIINDQZRRXXZDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6BO3P/c1-3-6-7(4)5-2/h1-2H3/q+1.
What are the key properties of CID 89063411?
CID 89063411 has a molecular weight of 119.85 g/mol, XLogP of 0.97, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89063411 is sourced from PubChem (CID 89063411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).