C17H18N2O4 — CID 89064803
tert-butyl 7-formyl-8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indole-5-carboxylate (PubChem CID 89064803) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is tert-butyl 7-formyl-8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indole-5-carboxylate.
| Compound Name | tert-butyl 7-formyl-8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 89064803 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | tert-butyl 7-formyl-8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2c(c3ncccc31)CC(=O)C(C=O)C2 |
| InChI | InChI=1S/C17H18N2O4/c1-17(2,3)23-16(22)19-12-5-4-6-18-15(12)11-8-14(21)10(9-20)7-13(11)19/h4-6,9-10H,7-8H2,1-3H3 |
| InChIKey | NSFPENKYZSKQPP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|