C22H30N2O5 — CID 89069307
1-O'-tert-butyl 1-O-prop-1-en-2-yl 2-hydroxy-2-methylspiro[indole-3,4'-piperidine]-1,1'-dicarboxylate (PubChem CID 89069307) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-prop-1-en-2-yl 2-hydroxy-2-methylspiro[indole-3,4'-piperidine]-1,1'-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-prop-1-en-2-yl 2-hydroxy-2-methylspiro[indole-3,4'-piperidine]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 89069307 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-O'-tert-butyl 1-O-prop-1-en-2-yl 2-hydroxy-2-methylspiro[indole-3,4'-piperidine]-1,1'-dicarboxylate |
| SMILES | C=C(C)OC(=O)N1c2ccccc2C2(CCN(C(=O)OC(C)(C)C)CC2)C1(C)O |
| InChI | InChI=1S/C22H30N2O5/c1-15(2)28-19(26)24-17-10-8-7-9-16(17)22(21(24,6)27)11-13-23(14-12-22)18(25)29-20(3,4)5/h7-10,27H,1,11-14H2,2-6H3 |
| InChIKey | DJJNFLZZLRLATR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|