C19H12Cl2F3N3O2S — CID 89072144
4-[4,4-bis(chloromethyl)-3-(4-hydroxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 89072144) has the molecular formula C19H12Cl2F3N3O2S and a molecular weight of 474.29 g/mol. Its IUPAC name is 4-[4,4-bis(chloromethyl)-3-(4-hydroxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4,4-bis(chloromethyl)-3-(4-hydroxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 89072144 |
| Molecular Formula | C19H12Cl2F3N3O2S |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | 4-[4,4-bis(chloromethyl)-3-(4-hydroxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C(CCl)(CCl)N(c3ccc(O)cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C19H12Cl2F3N3O2S/c20-9-18(10-21)16(29)26(17(30)27(18)12-3-5-14(28)6-4-12)13-2-1-11(8-25)15(7-13)19(22,23)24/h1-7,28H,9-10H2 |
| InChIKey | IHNOTRNJHDDUKK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|