C19H20F2N6O6S — CID 89072885
2-[[5-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-oxadiazepane-2-carbonyl]amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 89072885) has the molecular formula C19H20F2N6O6S and a molecular weight of 498.47 g/mol. Its IUPAC name is 2-[[5-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-oxadiazepane-2-carbonyl]amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[5-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-oxadiazepane-2-carbonyl]amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 89072885 |
| Molecular Formula | C19H20F2N6O6S |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 2-[[5-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-oxadiazepane-2-carbonyl]amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | NC[C@H]1CN(c2cc(F)c(N3CCON(C(=O)Nc4nc(C(=O)O)cs4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H20F2N6O6S/c20-12-5-10(26-8-11(7-22)33-19(26)31)6-13(21)15(12)25-1-2-27(32-4-3-25)18(30)24-17-23-14(9-34-17)16(28)29/h5-6,9,11H,1-4,7-8,22H2,(H,28,29)(H,23,24,30)/t11-/m0/s1 |
| InChIKey | MDKBJOOEKQLFHX-NSHDSACASA-N |
| XLogP | 1.69 |
| TPSA | 150.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|