C22H36N2O5 — CID 89083104
2-(4-acetyl-3-aminophenoxy)-N-[4-(1-methoxy-3-methylpentan-3-yl)oxy-2-methylbutan-2-yl]acetamide (PubChem CID 89083104) has the molecular formula C22H36N2O5 and a molecular weight of 408.54 g/mol. Its IUPAC name is 2-(4-acetyl-3-aminophenoxy)-N-[4-(1-methoxy-3-methylpentan-3-yl)oxy-2-methylbutan-2-yl]acetamide.
| Compound Name | 2-(4-acetyl-3-aminophenoxy)-N-[4-(1-methoxy-3-methylpentan-3-yl)oxy-2-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 89083104 |
| Molecular Formula | C22H36N2O5 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 2-(4-acetyl-3-aminophenoxy)-N-[4-(1-methoxy-3-methylpentan-3-yl)oxy-2-methylbutan-2-yl]acetamide |
| SMILES | CCC(C)(CCOC)OCCC(C)(C)NC(=O)COc1ccc(C(C)=O)c(N)c1 |
| InChI | InChI=1S/C22H36N2O5/c1-7-22(5,11-12-27-6)29-13-10-21(3,4)24-20(26)15-28-17-8-9-18(16(2)25)19(23)14-17/h8-9,14H,7,10-13,15,23H2,1-6H3,(H,24,26) |
| InChIKey | IFEXUHSLYFYRIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|