C23H36NO5+ — CID 91200922
2-(4-acetyl-3-ethylphenoxy)-N-[2-methyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]acetamide (PubChem CID 91200922) has the molecular formula C23H36NO5+ and a molecular weight of 406.54 g/mol. Its IUPAC name is 2-(4-acetyl-3-ethylphenoxy)-N-[2-methyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]acetamide.
| Compound Name | 2-(4-acetyl-3-ethylphenoxy)-N-[2-methyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]acetamide |
|---|---|
| PubChem CID | 91200922 |
| Molecular Formula | C23H36NO5+ |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2-(4-acetyl-3-ethylphenoxy)-N-[2-methyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]acetamide |
| SMILES | C[CH+]c1cc(OCC(=O)NCC(C)(CC)OCCOC(C)(C)C)ccc1C(C)=O |
| InChI | InChI=1S/C23H35NO5/c1-8-18-14-19(10-11-20(18)17(3)25)27-15-21(26)24-16-23(7,9-2)29-13-12-28-22(4,5)6/h8,10-11,14H,9,12-13,15-16H2,1-7H3/p+1 |
| InChIKey | TVCCZUKGWBVTIQ-UHFFFAOYSA-O |
| XLogP | 3.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|