C24H33N3O5S — CID 89084423
(2S)-1-formyl-N-[(1R,2S)-2-[(Z)-hept-1-enyl]-1-[(2-methylphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-2-carboxamide (PubChem CID 89084423) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is (2S)-1-formyl-N-[(1R,2S)-2-[(Z)-hept-1-enyl]-1-[(2-methylphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-formyl-N-[(1R,2S)-2-[(Z)-hept-1-enyl]-1-[(2-methylphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89084423 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (2S)-1-formyl-N-[(1R,2S)-2-[(Z)-hept-1-enyl]-1-[(2-methylphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-2-carboxamide |
| SMILES | CCCCC/C=C\[C@@H]1C[C@]1(NC(=O)[C@@H]1CCCN1C=O)C(=O)NS(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C24H33N3O5S/c1-3-4-5-6-7-12-19-16-24(19,25-22(29)20-13-10-15-27(20)17-28)23(30)26-33(31,32)21-14-9-8-11-18(21)2/h7-9,11-12,14,17,19-20H,3-6,10,13,15-16H2,1-2H3,(H,25,29)(H,26,30)/b12-7-/t19-,20+,24-/m1/s1 |
| InChIKey | HJJZROAJVLBYDV-GCNGLBSGSA-N |
| XLogP | 2.43 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|