C30H29F3N4O7S — CID 89084962
methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[[(E,6S)-1,1,1-trifluoro-6-[(4-nitrosophenyl)sulfonylamino]-7-oxohept-3-en-2-yl]amino]propan-2-yl]carbamate (PubChem CID 89084962) has the molecular formula C30H29F3N4O7S and a molecular weight of 646.64 g/mol. Its IUPAC name is methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[[(E,6S)-1,1,1-trifluoro-6-[(4-nitrosophenyl)sulfonylamino]-7-oxohept-3-en-2-yl]amino]propan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[[(E,6S)-1,1,1-trifluoro-6-[(4-nitrosophenyl)sulfonylamino]-7-oxohept-3-en-2-yl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 89084962 |
| Molecular Formula | C30H29F3N4O7S |
| Molecular Weight | 646.64 g/mol |
| Exact Mass | 646.17 |
| IUPAC Name | methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[[(E,6S)-1,1,1-trifluoro-6-[(4-nitrosophenyl)sulfonylamino]-7-oxohept-3-en-2-yl]amino]propan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)NC(/C=C/C[C@@H](C=O)NS(=O)(=O)c1ccc(N=O)cc1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H29F3N4O7S/c1-44-29(40)35-27(26(20-9-4-2-5-10-20)21-11-6-3-7-12-21)28(39)34-25(30(31,32)33)14-8-13-23(19-38)37-45(42,43)24-17-15-22(36-41)16-18-24/h2-12,14-19,23,25-27,37H,13H2,1H3,(H,34,39)(H,35,40)/b14-8+/t23-,25?,27-/m0/s1 |
| InChIKey | AZQUJCNSNLPNSH-HXSLLKOLSA-N |
| XLogP | 4.48 |
| TPSA | 160.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|