C8H13NO2 — CID 89086636
(4R,5R)-5-(hydroxyamino)bicyclo[2.2.1]heptane-2-carbaldehyde (PubChem CID 89086636) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (4R,5R)-5-(hydroxyamino)bicyclo[2.2.1]heptane-2-carbaldehyde.
| Compound Name | (4R,5R)-5-(hydroxyamino)bicyclo[2.2.1]heptane-2-carbaldehyde |
|---|---|
| PubChem CID | 89086636 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (4R,5R)-5-(hydroxyamino)bicyclo[2.2.1]heptane-2-carbaldehyde |
| SMILES | O=CC1C[C@H]2CC1C[C@H]2NO |
| InChI | InChI=1S/C8H13NO2/c10-4-7-2-6-1-5(7)3-8(6)9-11/h4-9,11H,1-3H2/t5?,6-,7?,8-/m1/s1 |
| InChIKey | PBSIOPBDSGKGDJ-WMEPKMGJSA-N |
| XLogP | 0.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|