C32H39ClN2O4 — CID 89089374
[2-[(1S,2R,13S,14S,16R,17R,18S,20S)-20-chloro-17-hydroxy-2,11,16,18-tetramethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-oxoethyl] acetate (PubChem CID 89089374) has the molecular formula C32H39ClN2O4 and a molecular weight of 551.13 g/mol. Its IUPAC name is [2-[(1S,2R,13S,14S,16R,17R,18S,20S)-20-chloro-17-hydroxy-2,11,16,18-tetramethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(1S,2R,13S,14S,16R,17R,18S,20S)-20-chloro-17-hydroxy-2,11,16,18-tetramethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 89089374 |
| Molecular Formula | C32H39ClN2O4 |
| Molecular Weight | 551.13 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | [2-[(1S,2R,13S,14S,16R,17R,18S,20S)-20-chloro-17-hydroxy-2,11,16,18-tetramethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)[C@H](C)C[C@H]2[C@@H]3CC(C)C4=Cc5c(cnn5-c5ccccc5)C[C@]4(C)[C@H]3[C@@H](Cl)C[C@@]21C |
| InChI | InChI=1S/C32H39ClN2O4/c1-18-11-23-25-12-19(2)32(38,28(37)17-39-20(3)36)31(25,5)15-26(33)29(23)30(4)14-21-16-34-35(27(21)13-24(18)30)22-9-7-6-8-10-22/h6-10,13,16,18-19,23,25-26,29,38H,11-12,14-15,17H2,1-5H3/t18?,19-,23+,25+,26+,29-,30+,31+,32+/m1/s1 |
| InChIKey | AFNBWAOVQJIIJU-PTWCQNBYSA-N |
| XLogP | 5.63 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.13 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|