C7H10FN — CID 89090864
(4-fluorocyclohexa-1,5-dien-1-yl)methanamine (PubChem CID 89090864) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is (4-fluorocyclohexa-1,5-dien-1-yl)methanamine.
| Compound Name | (4-fluorocyclohexa-1,5-dien-1-yl)methanamine |
|---|---|
| PubChem CID | 89090864 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | (4-fluorocyclohexa-1,5-dien-1-yl)methanamine |
| SMILES | NCC1=CCC(F)C=C1 |
| InChI | InChI=1S/C7H10FN/c8-7-3-1-6(5-9)2-4-7/h1-3,7H,4-5,9H2 |
| InChIKey | ZHQWMNJOALYHJS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |