C26H51NO3 — CID 89095592
tert-butyl N-[(E)-11-[(2-methylpropan-2-yl)oxy]heptadec-8-enyl]carbamate (PubChem CID 89095592) has the molecular formula C26H51NO3 and a molecular weight of 425.70 g/mol. Its IUPAC name is tert-butyl N-[(E)-11-[(2-methylpropan-2-yl)oxy]heptadec-8-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-11-[(2-methylpropan-2-yl)oxy]heptadec-8-enyl]carbamate |
|---|---|
| PubChem CID | 89095592 |
| Molecular Formula | C26H51NO3 |
| Molecular Weight | 425.70 g/mol |
| Exact Mass | 425.39 |
| IUPAC Name | tert-butyl N-[(E)-11-[(2-methylpropan-2-yl)oxy]heptadec-8-enyl]carbamate |
| SMILES | CCCCCCC(C/C=C/CCCCCCCNC(=O)OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C26H51NO3/c1-8-9-10-17-20-23(29-25(2,3)4)21-18-15-13-11-12-14-16-19-22-27-24(28)30-26(5,6)7/h15,18,23H,8-14,16-17,19-22H2,1-7H3,(H,27,28)/b18-15+ |
| InChIKey | ARZGVATUBBSFGY-OBGWFSINSA-N |
| XLogP | 7.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.70 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|