C28H34ClN3O6 — CID 89099103
tert-butyl 4-[2-[(5-chloro-2-formylphenyl)carbamoyl]-5-morpholin-4-ylphenoxy]piperidine-1-carboxylate (PubChem CID 89099103) has the molecular formula C28H34ClN3O6 and a molecular weight of 544.05 g/mol. Its IUPAC name is tert-butyl 4-[2-[(5-chloro-2-formylphenyl)carbamoyl]-5-morpholin-4-ylphenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(5-chloro-2-formylphenyl)carbamoyl]-5-morpholin-4-ylphenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89099103 |
| Molecular Formula | C28H34ClN3O6 |
| Molecular Weight | 544.05 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | tert-butyl 4-[2-[(5-chloro-2-formylphenyl)carbamoyl]-5-morpholin-4-ylphenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2cc(N3CCOCC3)ccc2C(=O)Nc2cc(Cl)ccc2C=O)CC1 |
| InChI | InChI=1S/C28H34ClN3O6/c1-28(2,3)38-27(35)32-10-8-22(9-11-32)37-25-17-21(31-12-14-36-15-13-31)6-7-23(25)26(34)30-24-16-20(29)5-4-19(24)18-33/h4-7,16-18,22H,8-15H2,1-3H3,(H,30,34) |
| InChIKey | JONIHFMDYWKDJZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.05 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|