C26H35N3O6S — CID 89198653
tert-butyl 4-[2-[[2-(hydroperoxymethyl)thiophen-3-yl]carbamoyl]-5-pyrrolidin-1-ylphenoxy]piperidine-1-carboxylate (PubChem CID 89198653) has the molecular formula C26H35N3O6S and a molecular weight of 517.65 g/mol. Its IUPAC name is tert-butyl 4-[2-[[2-(hydroperoxymethyl)thiophen-3-yl]carbamoyl]-5-pyrrolidin-1-ylphenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[2-(hydroperoxymethyl)thiophen-3-yl]carbamoyl]-5-pyrrolidin-1-ylphenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89198653 |
| Molecular Formula | C26H35N3O6S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | tert-butyl 4-[2-[[2-(hydroperoxymethyl)thiophen-3-yl]carbamoyl]-5-pyrrolidin-1-ylphenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2cc(N3CCCC3)ccc2C(=O)Nc2ccsc2COO)CC1 |
| InChI | InChI=1S/C26H35N3O6S/c1-26(2,3)35-25(31)29-13-8-19(9-14-29)34-22-16-18(28-11-4-5-12-28)6-7-20(22)24(30)27-21-10-15-36-23(21)17-33-32/h6-7,10,15-16,19,32H,4-5,8-9,11-14,17H2,1-3H3,(H,27,30) |
| InChIKey | TXFOVNDVXCRSTC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|