About 2-methylidenecyclohexane-1,3-diamine
2-methylidenecyclohexane-1,3-diamine (PubChem CID 89104268) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-methylidenecyclohexane-1,3-diamine.
Molecular Properties
| Compound Name | 2-methylidenecyclohexane-1,3-diamine |
| PubChem CID | 89104268 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2-methylidenecyclohexane-1,3-diamine |
| SMILES | C=C1C(N)CCCC1N |
| InChI | InChI=1S/C7H14N2/c1-5-6(8)3-2-4-7(5)9/h6-7H,1-4,8-9H2 |
| InChIKey | RIFIINASQXNNQP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenecyclohexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenecyclohexane-1,3-diamine?
The IUPAC name of 2-methylidenecyclohexane-1,3-diamine (CID 89104268) is 2-methylidenecyclohexane-1,3-diamine.
What is the SMILES notation for 2-methylidenecyclohexane-1,3-diamine?
The canonical SMILES for 2-methylidenecyclohexane-1,3-diamine is C=C1C(N)CCCC1N.
What is the InChIKey of 2-methylidenecyclohexane-1,3-diamine?
The InChIKey is RIFIINASQXNNQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-5-6(8)3-2-4-7(5)9/h6-7H,1-4,8-9H2.
What are the key properties of 2-methylidenecyclohexane-1,3-diamine?
2-methylidenecyclohexane-1,3-diamine has a molecular weight of 126.20 g/mol, XLogP of 0.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenecyclohexane-1,3-diamine is sourced from PubChem (CID 89104268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).