C7H14N2 — CID 89104268
2-methylidenecyclohexane-1,3-diamine (PubChem CID 89104268) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-methylidenecyclohexane-1,3-diamine.
| Compound Name | 2-methylidenecyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 89104268 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2-methylidenecyclohexane-1,3-diamine |
| SMILES | C=C1C(N)CCCC1N |
| InChI | InChI=1S/C7H14N2/c1-5-6(8)3-2-4-7(5)9/h6-7H,1-4,8-9H2 |
| InChIKey | RIFIINASQXNNQP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|