C19H30N2 — CID 89105849
6-ethenyl-4-[4-(piperidin-1-ylmethyl)cyclohex-3-en-1-yl]-1,2,3,4-tetrahydropyridine (PubChem CID 89105849) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 6-ethenyl-4-[4-(piperidin-1-ylmethyl)cyclohex-3-en-1-yl]-1,2,3,4-tetrahydropyridine.
| Compound Name | 6-ethenyl-4-[4-(piperidin-1-ylmethyl)cyclohex-3-en-1-yl]-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 89105849 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 6-ethenyl-4-[4-(piperidin-1-ylmethyl)cyclohex-3-en-1-yl]-1,2,3,4-tetrahydropyridine |
| SMILES | C=CC1=CC(C2CC=C(CN3CCCCC3)CC2)CCN1 |
| InChI | InChI=1S/C19H30N2/c1-2-19-14-18(10-11-20-19)17-8-6-16(7-9-17)15-21-12-4-3-5-13-21/h2,6,14,17-18,20H,1,3-5,7-13,15H2 |
| InChIKey | NEIOSTMNNRUAAR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|