C15H15N5O2S — CID 89108440
(2S,6Z)-6-[[4-(azidomethyl)-2-pyridinyl]methylidene]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbaldehyde (PubChem CID 89108440) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is (2S,6Z)-6-[[4-(azidomethyl)-2-pyridinyl]methylidene]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbaldehyde.
| Compound Name | (2S,6Z)-6-[[4-(azidomethyl)-2-pyridinyl]methylidene]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbaldehyde |
|---|---|
| PubChem CID | 89108440 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (2S,6Z)-6-[[4-(azidomethyl)-2-pyridinyl]methylidene]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbaldehyde |
| SMILES | CC1(C)SC2/C(=C\c3cc(CN=[N+]=[N-])ccn3)C(=O)N2[C@H]1C=O |
| InChI | InChI=1S/C15H15N5O2S/c1-15(2)12(8-21)20-13(22)11(14(20)23-15)6-10-5-9(3-4-17-10)7-18-19-16/h3-6,8,12,14H,7H2,1-2H3/b11-6-/t12-,14?/m0/s1 |
| InChIKey | OOFUFXVEGNHJIR-LSSMMDADSA-N |
| XLogP | 2.54 |
| TPSA | 99.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|