C13H10N2O5 — CID 89112682
(6bS)-5-(2,6-dioxopiperidin-3-yl)-1a,6b-dihydrooxireno[2,3-e]isoindole-4,6-dione (PubChem CID 89112682) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is (6bS)-5-(2,6-dioxopiperidin-3-yl)-1a,6b-dihydrooxireno[2,3-e]isoindole-4,6-dione.
| Compound Name | (6bS)-5-(2,6-dioxopiperidin-3-yl)-1a,6b-dihydrooxireno[2,3-e]isoindole-4,6-dione |
|---|---|
| PubChem CID | 89112682 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (6bS)-5-(2,6-dioxopiperidin-3-yl)-1a,6b-dihydrooxireno[2,3-e]isoindole-4,6-dione |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)[C@@H]2OC2C=C3)C(=O)N1 |
| InChI | InChI=1S/C13H10N2O5/c16-8-4-2-6(11(17)14-8)15-12(18)5-1-3-7-10(20-7)9(5)13(15)19/h1,3,6-7,10H,2,4H2,(H,14,16,17)/t6?,7?,10-/m1/s1 |
| InChIKey | CPEIEMDPLXDOJT-HNQUHTCLSA-N |
| XLogP | -1.21 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|