C12H14F2O6 — CID 89113974
4-O-(2,2-difluoropropyl) 1-O-(2-oxooxolan-3-yl) 2-methylidenebutanedioate (PubChem CID 89113974) has the molecular formula C12H14F2O6 and a molecular weight of 292.23 g/mol. Its IUPAC name is 4-O-(2,2-difluoropropyl) 1-O-(2-oxooxolan-3-yl) 2-methylidenebutanedioate.
| Compound Name | 4-O-(2,2-difluoropropyl) 1-O-(2-oxooxolan-3-yl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 89113974 |
| Molecular Formula | C12H14F2O6 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-O-(2,2-difluoropropyl) 1-O-(2-oxooxolan-3-yl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCC(C)(F)F)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C12H14F2O6/c1-7(5-9(15)19-6-12(2,13)14)10(16)20-8-3-4-18-11(8)17/h8H,1,3-6H2,2H3 |
| InChIKey | LZQWMCIZHQCXJU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|